C14H20N2O4S — CID 82777787
ethyl 4-amino-3-[(1,1-dioxothiolan-3-yl)-methylamino]benzoate (PubChem CID 82777787) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 4-amino-3-[(1,1-dioxothiolan-3-yl)-methylamino]benzoate.
| Compound Name | ethyl 4-amino-3-[(1,1-dioxothiolan-3-yl)-methylamino]benzoate |
|---|---|
| PubChem CID | 82777787 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 4-amino-3-[(1,1-dioxothiolan-3-yl)-methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(N(C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H20N2O4S/c1-3-20-14(17)10-4-5-12(15)13(8-10)16(2)11-6-7-21(18,19)9-11/h4-5,8,11H,3,6-7,9,15H2,1-2H3 |
| InChIKey | LVZNRSKXBAFSCT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|