C12H15FN2O4S — CID 83215739
2-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-fluorobenzoic acid (PubChem CID 83215739) has the molecular formula C12H15FN2O4S and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83215739 |
| Molecular Formula | C12H15FN2O4S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-fluorobenzoic acid |
| SMILES | CN(c1ccc(F)c(N)c1C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15FN2O4S/c1-15(7-4-5-20(18,19)6-7)9-3-2-8(13)11(14)10(9)12(16)17/h2-3,7H,4-6,14H2,1H3,(H,16,17) |
| InChIKey | HGVRYLYRNWLNLU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|