C12H18N4O2S2 — CID 61098646
3-[(1,1-dioxothiolan-3-yl)-methylamino]-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 61098646) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 61098646 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(N(C)C2CCS(=O)(=O)C2)c(C(N)=S)c1C |
| InChI | InChI=1S/C12H18N4O2S2/c1-7-8(2)14-15-12(10(7)11(13)19)16(3)9-4-5-20(17,18)6-9/h9H,4-6H2,1-3H3,(H2,13,19) |
| InChIKey | TUJIEDPNOCVNAE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|