C10H14N2O2 — CID 62253488
2-(4-amino-N,2-dimethylanilino)acetic acid (PubChem CID 62253488) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(4-amino-N,2-dimethylanilino)acetic acid.
| Compound Name | 2-(4-amino-N,2-dimethylanilino)acetic acid |
|---|---|
| PubChem CID | 62253488 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-(4-amino-N,2-dimethylanilino)acetic acid |
| SMILES | Cc1cc(N)ccc1N(C)CC(=O)O |
| InChI | InChI=1S/C10H14N2O2/c1-7-5-8(11)3-4-9(7)12(2)6-10(13)14/h3-5H,6,11H2,1-2H3,(H,13,14) |
| InChIKey | MYNCHKYIQIUZKH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|