C15H18N2 — CID 43165465
1-N-benzyl-1-N,2-dimethylbenzene-1,4-diamine (PubChem CID 43165465) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-N-benzyl-1-N,2-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-benzyl-1-N,2-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 43165465 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1-N-benzyl-1-N,2-dimethylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1N(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2/c1-12-10-14(16)8-9-15(12)17(2)11-13-6-4-3-5-7-13/h3-10H,11,16H2,1-2H3 |
| InChIKey | PAYUBRVHTJEMGH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|