C11H18N2O — CID 104551064
2-(4-amino-N,2-dimethylanilino)propan-1-ol (PubChem CID 104551064) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(4-amino-N,2-dimethylanilino)propan-1-ol.
| Compound Name | 2-(4-amino-N,2-dimethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 104551064 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(4-amino-N,2-dimethylanilino)propan-1-ol |
| SMILES | Cc1cc(N)ccc1N(C)C(C)CO |
| InChI | InChI=1S/C11H18N2O/c1-8-6-10(12)4-5-11(8)13(3)9(2)7-14/h4-6,9,14H,7,12H2,1-3H3 |
| InChIKey | PYXNIBQZIKDLAJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|