C13H21N3O2 — CID 104551127
4-amino-2-[1-hydroxypropan-2-yl(methyl)amino]-N,N-dimethylbenzamide (PubChem CID 104551127) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-amino-2-[1-hydroxypropan-2-yl(methyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 4-amino-2-[1-hydroxypropan-2-yl(methyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 104551127 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-amino-2-[1-hydroxypropan-2-yl(methyl)amino]-N,N-dimethylbenzamide |
| SMILES | CC(CO)N(C)c1cc(N)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C13H21N3O2/c1-9(8-17)16(4)12-7-10(14)5-6-11(12)13(18)15(2)3/h5-7,9,17H,8,14H2,1-4H3 |
| InChIKey | KZGCDTHCZHDRNJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|