C10H13FN2O2 — CID 103590283
2-(2-amino-4-fluoro-N,5-dimethylanilino)acetic acid (PubChem CID 103590283) has the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-(2-amino-4-fluoro-N,5-dimethylanilino)acetic acid.
| Compound Name | 2-(2-amino-4-fluoro-N,5-dimethylanilino)acetic acid |
|---|---|
| PubChem CID | 103590283 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(2-amino-4-fluoro-N,5-dimethylanilino)acetic acid |
| SMILES | Cc1cc(N(C)CC(=O)O)c(N)cc1F |
| InChI | InChI=1S/C10H13FN2O2/c1-6-3-9(8(12)4-7(6)11)13(2)5-10(14)15/h3-4H,5,12H2,1-2H3,(H,14,15) |
| InChIKey | WKABUALKEQNUCQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|