C12H18FN3O2 — CID 63592936
2-(2-amino-4-fluoro-N-methyl-5-propoxyanilino)acetamide (PubChem CID 63592936) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-(2-amino-4-fluoro-N-methyl-5-propoxyanilino)acetamide.
| Compound Name | 2-(2-amino-4-fluoro-N-methyl-5-propoxyanilino)acetamide |
|---|---|
| PubChem CID | 63592936 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(2-amino-4-fluoro-N-methyl-5-propoxyanilino)acetamide |
| SMILES | CCCOc1cc(N(C)CC(N)=O)c(N)cc1F |
| InChI | InChI=1S/C12H18FN3O2/c1-3-4-18-11-6-10(9(14)5-8(11)13)16(2)7-12(15)17/h5-6H,3-4,7,14H2,1-2H3,(H2,15,17) |
| InChIKey | FKNCEGXAMBZJFH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|