C16H28FN3O — CID 63592798
1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-propoxy-1-N-propylbenzene-1,2-diamine (PubChem CID 63592798) has the molecular formula C16H28FN3O and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-propoxy-1-N-propylbenzene-1,2-diamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-propoxy-1-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 63592798 |
| Molecular Formula | C16H28FN3O |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-propoxy-1-N-propylbenzene-1,2-diamine |
| SMILES | CCCOc1cc(N(CCC)CCN(C)C)c(N)cc1F |
| InChI | InChI=1S/C16H28FN3O/c1-5-7-20(9-8-19(3)4)15-12-16(21-10-6-2)13(17)11-14(15)18/h11-12H,5-10,18H2,1-4H3 |
| InChIKey | CWPOTKRFRZUFCF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|