C13H22FN3 — CID 62378190
2-N-[2-(dimethylamino)ethyl]-4-fluoro-2-N-propylbenzene-1,2-diamine (PubChem CID 62378190) has the molecular formula C13H22FN3 and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-4-fluoro-2-N-propylbenzene-1,2-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-4-fluoro-2-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 62378190 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-4-fluoro-2-N-propylbenzene-1,2-diamine |
| SMILES | CCCN(CCN(C)C)c1cc(F)ccc1N |
| InChI | InChI=1S/C13H22FN3/c1-4-7-17(9-8-16(2)3)13-10-11(14)5-6-12(13)15/h5-6,10H,4,7-9,15H2,1-3H3 |
| InChIKey | JVTRIGZRXVLORU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|