C13H24N4 — CID 106750685
4-N-[2-(dimethylamino)ethyl]-4-N-propylbenzene-1,2,4-triamine (PubChem CID 106750685) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-4-N-propylbenzene-1,2,4-triamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-4-N-propylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750685 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-4-N-propylbenzene-1,2,4-triamine |
| SMILES | CCCN(CCN(C)C)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C13H24N4/c1-4-7-17(9-8-16(2)3)11-5-6-12(14)13(15)10-11/h5-6,10H,4,7-9,14-15H2,1-3H3 |
| InChIKey | JJZBDWOIFZITSK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|