C13H21FN2O3 — CID 63597825
4-fluoro-5-methoxy-1-N,1-N-bis(2-methoxyethyl)benzene-1,2-diamine (PubChem CID 63597825) has the molecular formula C13H21FN2O3 and a molecular weight of 272.32 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1-N,1-N-bis(2-methoxyethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methoxy-1-N,1-N-bis(2-methoxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63597825 |
| Molecular Formula | C13H21FN2O3 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-fluoro-5-methoxy-1-N,1-N-bis(2-methoxyethyl)benzene-1,2-diamine |
| SMILES | COCCN(CCOC)c1cc(OC)c(F)cc1N |
| InChI | InChI=1S/C13H21FN2O3/c1-17-6-4-16(5-7-18-2)12-9-13(19-3)10(14)8-11(12)15/h8-9H,4-7,15H2,1-3H3 |
| InChIKey | XJAKPRBXGKJMHA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|