C15H26FN3O — CID 63597494
1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methoxy-1-N-(2-methylpropyl)benzene-1,2-diamine (PubChem CID 63597494) has the molecular formula C15H26FN3O and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methoxy-1-N-(2-methylpropyl)benzene-1,2-diamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methoxy-1-N-(2-methylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63597494 |
| Molecular Formula | C15H26FN3O |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methoxy-1-N-(2-methylpropyl)benzene-1,2-diamine |
| SMILES | COc1cc(N(CCN(C)C)CC(C)C)c(N)cc1F |
| InChI | InChI=1S/C15H26FN3O/c1-11(2)10-19(7-6-18(3)4)14-9-15(20-5)12(16)8-13(14)17/h8-9,11H,6-7,10,17H2,1-5H3 |
| InChIKey | JPRJCJLTLHLPQX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|