C11H14ClN3S2 — CID 62581043
N-[(5-chlorothiophen-2-yl)methyl]-2-(1-methylpyrazol-4-yl)sulfanylethanamine (PubChem CID 62581043) has the molecular formula C11H14ClN3S2 and a molecular weight of 287.84 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(1-methylpyrazol-4-yl)sulfanylethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1-methylpyrazol-4-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 62581043 |
| Molecular Formula | C11H14ClN3S2 |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1-methylpyrazol-4-yl)sulfanylethanamine |
| SMILES | Cn1cc(SCCNCc2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C11H14ClN3S2/c1-15-8-10(7-14-15)16-5-4-13-6-9-2-3-11(12)17-9/h2-3,7-8,13H,4-6H2,1H3 |
| InChIKey | SRJXCUJJPPNMIJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|