C11H15N3OS — CID 62580322
N-(furan-2-ylmethyl)-2-(1-methylpyrazol-4-yl)sulfanylethanamine (PubChem CID 62580322) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(1-methylpyrazol-4-yl)sulfanylethanamine.
| Compound Name | N-(furan-2-ylmethyl)-2-(1-methylpyrazol-4-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 62580322 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(1-methylpyrazol-4-yl)sulfanylethanamine |
| SMILES | Cn1cc(SCCNCc2ccco2)cn1 |
| InChI | InChI=1S/C11H15N3OS/c1-14-9-11(8-13-14)16-6-4-12-7-10-3-2-5-15-10/h2-3,5,8-9,12H,4,6-7H2,1H3 |
| InChIKey | FTXPYEMGFCAGDB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|