C10H13N3OS3 — CID 113298812
N-(furan-2-ylmethyl)-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanamine (PubChem CID 113298812) has the molecular formula C10H13N3OS3 and a molecular weight of 287.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanamine.
| Compound Name | N-(furan-2-ylmethyl)-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanamine |
|---|---|
| PubChem CID | 113298812 |
| Molecular Formula | C10H13N3OS3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanamine |
| SMILES | CSc1nnc(SCCNCc2ccco2)s1 |
| InChI | InChI=1S/C10H13N3OS3/c1-15-9-12-13-10(17-9)16-6-4-11-7-8-3-2-5-14-8/h2-3,5,11H,4,6-7H2,1H3 |
| InChIKey | PBEGFCLIULLFTH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|