C10H11BrN2OS2 — CID 106925785
N-[(4-bromothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine (PubChem CID 106925785) has the molecular formula C10H11BrN2OS2 and a molecular weight of 319.25 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106925785 |
| Molecular Formula | C10H11BrN2OS2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine |
| SMILES | Brc1csc(CNCCSc2ncco2)c1 |
| InChI | InChI=1S/C10H11BrN2OS2/c11-8-5-9(16-7-8)6-12-2-4-15-10-13-1-3-14-10/h1,3,5,7,12H,2,4,6H2 |
| InChIKey | FGMMHHIFKMWBKF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|