C11H14BrN3S — CID 115580177
N-[(4-bromothiophen-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine (PubChem CID 115580177) has the molecular formula C11H14BrN3S and a molecular weight of 300.22 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 115580177 |
| Molecular Formula | C11H14BrN3S |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine |
| SMILES | Brc1csc(CNCCCn2cccn2)c1 |
| InChI | InChI=1S/C11H14BrN3S/c12-10-7-11(16-9-10)8-13-3-1-5-15-6-2-4-14-15/h2,4,6-7,9,13H,1,3,5,8H2 |
| InChIKey | NOMIZOGWTOZSQM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|