C14H13FN4S — CID 62850910
4-fluoro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]aniline (PubChem CID 62850910) has the molecular formula C14H13FN4S and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-fluoro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]aniline.
| Compound Name | 4-fluoro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]aniline |
|---|---|
| PubChem CID | 62850910 |
| Molecular Formula | C14H13FN4S |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-fluoro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]aniline |
| SMILES | Fc1ccc(NCCSc2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C14H13FN4S/c15-11-4-6-12(7-5-11)16-8-10-20-14-18-17-13-3-1-2-9-19(13)14/h1-7,9,16H,8,10H2 |
| InChIKey | DPDYPVKKSZFTEI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|