C16H14ClN5O3S — CID 7888739
2-(4-chlorophenoxy)-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]acetohydrazide (PubChem CID 7888739) has the molecular formula C16H14ClN5O3S and a molecular weight of 391.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]acetohydrazide.
| Compound Name | 2-(4-chlorophenoxy)-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 7888739 |
| Molecular Formula | C16H14ClN5O3S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-(4-chlorophenoxy)-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1)NNC(=O)CSc1nnc2ccccn12 |
| InChI | InChI=1S/C16H14ClN5O3S/c17-11-4-6-12(7-5-11)25-9-14(23)19-20-15(24)10-26-16-21-18-13-3-1-2-8-22(13)16/h1-8H,9-10H2,(H,19,23)(H,20,24) |
| InChIKey | ZKLBPARJUCGIIE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|