C17H18N6O3S — CID 8658930
N'-[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide (PubChem CID 8658930) has the molecular formula C17H18N6O3S and a molecular weight of 386.44 g/mol. Its IUPAC name is N'-[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8658930 |
| Molecular Formula | C17H18N6O3S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N'-[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide |
| SMILES | CC(C)c1ccc(-n2nnnc2SCC(=O)NNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C17H18N6O3S/c1-11(2)12-5-7-13(8-6-12)23-17(20-21-22-23)27-10-15(24)18-19-16(25)14-4-3-9-26-14/h3-9,11H,10H2,1-2H3,(H,18,24)(H,19,25) |
| InChIKey | GGAJLADBGSCESE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|