C23H25N5O2S — CID 16535844
2-[4-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylbutyl]isoindole-1,3-dione (PubChem CID 16535844) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[4-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylbutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylbutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 16535844 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[4-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylbutyl]isoindole-1,3-dione |
| SMILES | CCCCc1ccc(-n2nnnc2SCCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H25N5O2S/c1-2-3-8-17-11-13-18(14-12-17)28-23(24-25-26-28)31-16-7-6-15-27-21(29)19-9-4-5-10-20(19)22(27)30/h4-5,9-14H,2-3,6-8,15-16H2,1H3 |
| InChIKey | HPIAGEIPTMYQRY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|