C19H27N5OS — CID 112780368
2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-methylpiperidin-1-yl)ethanone (PubChem CID 112780368) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 112780368 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-methylpiperidin-1-yl)ethanone |
| SMILES | CCCCc1ccc(-n2nnnc2SCC(=O)N2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C19H27N5OS/c1-3-4-7-16-8-10-17(11-9-16)24-19(20-21-22-24)26-14-18(25)23-12-5-6-15(2)13-23/h8-11,15H,3-7,12-14H2,1-2H3 |
| InChIKey | SUINSOYRHGJDES-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |