C12H10N4OS3 — CID 18147442
5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione (PubChem CID 18147442) has the molecular formula C12H10N4OS3 and a molecular weight of 322.44 g/mol. Its IUPAC name is 5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 18147442 |
| Molecular Formula | C12H10N4OS3 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1noc(CSc2nn(-c3ccccc3)c(=S)s2)n1 |
| InChI | InChI=1S/C12H10N4OS3/c1-8-13-10(17-15-8)7-19-11-14-16(12(18)20-11)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | AMVQJZJKPFKGSR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|