C19H15N3OS3 — CID 8580973
3-(2-methylphenyl)-5-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione (PubChem CID 8580973) has the molecular formula C19H15N3OS3 and a molecular weight of 397.55 g/mol. Its IUPAC name is 3-(2-methylphenyl)-5-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-(2-methylphenyl)-5-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 8580973 |
| Molecular Formula | C19H15N3OS3 |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 3-(2-methylphenyl)-5-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1ccccc1-n1nc(SCc2cc(-c3ccccc3)on2)sc1=S |
| InChI | InChI=1S/C19H15N3OS3/c1-13-7-5-6-10-16(13)22-19(24)26-18(20-22)25-12-15-11-17(23-21-15)14-8-3-2-4-9-14/h2-11H,12H2,1H3 |
| InChIKey | HUFFZHXREVHRJF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|