C16H13N3O2S3 — CID 7607810
3-(2-methylphenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazole-2-thione (PubChem CID 7607810) has the molecular formula C16H13N3O2S3 and a molecular weight of 375.50 g/mol. Its IUPAC name is 3-(2-methylphenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-(2-methylphenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 7607810 |
| Molecular Formula | C16H13N3O2S3 |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 3-(2-methylphenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1ccccc1-n1nc(SCc2ccccc2[N+](=O)[O-])sc1=S |
| InChI | InChI=1S/C16H13N3O2S3/c1-11-6-2-4-8-13(11)18-16(22)24-15(17-18)23-10-12-7-3-5-9-14(12)19(20)21/h2-9H,10H2,1H3 |
| InChIKey | PZGZUPOLVRTIAX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|