C17H11FN4OS3 — CID 7528650
3-(4-fluorophenyl)-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione (PubChem CID 7528650) has the molecular formula C17H11FN4OS3 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-(4-fluorophenyl)-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 7528650 |
| Molecular Formula | C17H11FN4OS3 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 3-(4-fluorophenyl)-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
| SMILES | Fc1ccc(-n2nc(SCc3nnc(-c4ccccc4)o3)sc2=S)cc1 |
| InChI | InChI=1S/C17H11FN4OS3/c18-12-6-8-13(9-7-12)22-17(24)26-16(21-22)25-10-14-19-20-15(23-14)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | TVTNJYPTPLLEFR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|