C17H20FN3OS3 — CID 9075495
1-(azocan-1-yl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 9075495) has the molecular formula C17H20FN3OS3 and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-(azocan-1-yl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(azocan-1-yl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 9075495 |
| Molecular Formula | C17H20FN3OS3 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-(azocan-1-yl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nn(-c2ccc(F)cc2)c(=S)s1)N1CCCCCCC1 |
| InChI | InChI=1S/C17H20FN3OS3/c18-13-6-8-14(9-7-13)21-17(23)25-16(19-21)24-12-15(22)20-10-4-2-1-3-5-11-20/h6-9H,1-5,10-12H2 |
| InChIKey | YYBOPQAXJZPRAU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|