C18H21N3O3S3 — CID 5128191
[2-(azepan-1-yl)-2-oxoethyl] 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate (PubChem CID 5128191) has the molecular formula C18H21N3O3S3 and a molecular weight of 423.59 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate |
|---|---|
| PubChem CID | 5128191 |
| Molecular Formula | C18H21N3O3S3 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate |
| SMILES | CSc1nn(-c2ccc(C(=O)OCC(=O)N3CCCCCC3)cc2)c(=S)s1 |
| InChI | InChI=1S/C18H21N3O3S3/c1-26-17-19-21(18(25)27-17)14-8-6-13(7-9-14)16(23)24-12-15(22)20-10-4-2-3-5-11-20/h6-9H,2-5,10-12H2,1H3 |
| InChIKey | MUXMUMDAETXAEV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|