C22H19N3O4S3 — CID 2561136
4-(1,3-dioxoisoindol-2-yl)butyl 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate (PubChem CID 2561136) has the molecular formula C22H19N3O4S3 and a molecular weight of 485.61 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate |
|---|---|
| PubChem CID | 2561136 |
| Molecular Formula | C22H19N3O4S3 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 4-(5-methylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)benzoate |
| SMILES | CSc1nn(-c2ccc(C(=O)OCCCCN3C(=O)c4ccccc4C3=O)cc2)c(=S)s1 |
| InChI | InChI=1S/C22H19N3O4S3/c1-31-21-23-25(22(30)32-21)15-10-8-14(9-11-15)20(28)29-13-5-4-12-24-18(26)16-6-2-3-7-17(16)19(24)27/h2-3,6-11H,4-5,12-13H2,1H3 |
| InChIKey | WDDFVDWNUZMEBE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|