C23H22F3NO3 — CID 7263130
1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone (PubChem CID 7263130) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone.
| Compound Name | 1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 7263130 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone |
| SMILES | CCOc1ccc(-n2c(C)cc(C(=O)COc3ccc(C(F)(F)F)cc3)c2C)cc1 |
| InChI | InChI=1S/C23H22F3NO3/c1-4-29-19-11-7-18(8-12-19)27-15(2)13-21(16(27)3)22(28)14-30-20-9-5-17(6-10-20)23(24,25)26/h5-13H,4,14H2,1-3H3 |
| InChIKey | HQASHQNNUCZAHN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|