C15H17N2O5P-2 — CID 7689761
1-(4-ethoxyphenyl)-2,5-dimethyl-N-phosphonatopyrrole-3-carboxamide (PubChem CID 7689761) has the molecular formula C15H17N2O5P-2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,5-dimethyl-N-phosphonatopyrrole-3-carboxamide.
| Compound Name | 1-(4-ethoxyphenyl)-2,5-dimethyl-N-phosphonatopyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7689761 |
| Molecular Formula | C15H17N2O5P-2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,5-dimethyl-N-phosphonatopyrrole-3-carboxamide |
| SMILES | CCOc1ccc(-n2c(C)cc(C(=O)NP(=O)([O-])[O-])c2C)cc1 |
| InChI | InChI=1S/C15H19N2O5P/c1-4-22-13-7-5-12(6-8-13)17-10(2)9-14(11(17)3)15(18)16-23(19,20)21/h5-9H,4H2,1-3H3,(H3,16,18,19,20,21)/p-2 |
| InChIKey | SMCYFPPKNKRWJV-UHFFFAOYSA-L |
| XLogP | 1.05 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|