C19H19N2O4P — CID 2322164
[[2,5-dimethyl-1-(4-phenylphenyl)pyrrole-3-carbonyl]amino]phosphonic acid (PubChem CID 2322164) has the molecular formula C19H19N2O4P and a molecular weight of 370.35 g/mol. Its IUPAC name is [[2,5-dimethyl-1-(4-phenylphenyl)pyrrole-3-carbonyl]amino]phosphonic acid.
| Compound Name | [[2,5-dimethyl-1-(4-phenylphenyl)pyrrole-3-carbonyl]amino]phosphonic acid |
|---|---|
| PubChem CID | 2322164 |
| Molecular Formula | C19H19N2O4P |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [[2,5-dimethyl-1-(4-phenylphenyl)pyrrole-3-carbonyl]amino]phosphonic acid |
| SMILES | Cc1cc(C(=O)NP(=O)(O)O)c(C)n1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N2O4P/c1-13-12-18(19(22)20-26(23,24)25)14(2)21(13)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-12H,1-2H3,(H3,20,22,23,24,25) |
| InChIKey | ITNKBDDTPXVFSL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|