C23H26N2O3 — CID 34741571
N-(2,5-diethoxyphenyl)-2,5-dimethyl-1-phenylpyrrole-3-carboxamide (PubChem CID 34741571) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2,5-dimethyl-1-phenylpyrrole-3-carboxamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 34741571 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)c2cc(C)n(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C23H26N2O3/c1-5-27-19-12-13-22(28-6-2)21(15-19)24-23(26)20-14-16(3)25(17(20)4)18-10-8-7-9-11-18/h7-15H,5-6H2,1-4H3,(H,24,26) |
| InChIKey | IPUNQYVKDLAWQO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|