C21H32BrN4O2P — CID 98389247
N-bis[[(2S)-butan-2-yl]amino]phosphoryl-1-(4-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 98389247) has the molecular formula C21H32BrN4O2P and a molecular weight of 483.39 g/mol. Its IUPAC name is N-bis[[(2S)-butan-2-yl]amino]phosphoryl-1-(4-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-bis[[(2S)-butan-2-yl]amino]phosphoryl-1-(4-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 98389247 |
| Molecular Formula | C21H32BrN4O2P |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-bis[[(2S)-butan-2-yl]amino]phosphoryl-1-(4-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | CC[C@H](C)NP(=O)(NC(=O)c1cc(C)n(-c2ccc(Br)cc2)c1C)N[C@@H](C)CC |
| InChI | InChI=1S/C21H32BrN4O2P/c1-7-14(3)23-29(28,24-15(4)8-2)25-21(27)20-13-16(5)26(17(20)6)19-11-9-18(22)10-12-19/h9-15H,7-8H2,1-6H3,(H3,23,24,25,27,28)/t14-,15-/m0/s1 |
| InChIKey | MPCIYRGRNDHEQH-GJZGRUSLSA-N |
| XLogP | 5.47 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|