C21H28FN3O2 — CID 86949670
1-(4-fluorophenyl)-2,5-dimethyl-N-(4-morpholin-4-ylbutan-2-yl)pyrrole-3-carboxamide (PubChem CID 86949670) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,5-dimethyl-N-(4-morpholin-4-ylbutan-2-yl)pyrrole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-(4-morpholin-4-ylbutan-2-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 86949670 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-(4-morpholin-4-ylbutan-2-yl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)CCN2CCOCC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H28FN3O2/c1-15(8-9-24-10-12-27-13-11-24)23-21(26)20-14-16(2)25(17(20)3)19-6-4-18(22)5-7-19/h4-7,14-15H,8-13H2,1-3H3,(H,23,26) |
| InChIKey | ISSDJRFGASUXIV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|