C22H23FN2O3S — CID 55440522
1-(4-fluorophenyl)-2,5-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrrole-3-carboxamide (PubChem CID 55440522) has the molecular formula C22H23FN2O3S and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,5-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55440522 |
| Molecular Formula | C22H23FN2O3S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O3S/c1-14-13-21(16(3)25(14)19-9-7-18(23)8-10-19)22(26)24-15(2)17-5-11-20(12-6-17)29(4,27)28/h5-13,15H,1-4H3,(H,24,26) |
| InChIKey | MRZYXLRCZDBSBE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|