C24H24FNO4 — CID 7844764
[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate (PubChem CID 7844764) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate.
| Compound Name | [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 7844764 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate |
| SMILES | CCc1ccc(OCC(=O)OCC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H24FNO4/c1-4-18-5-11-21(12-6-18)29-15-24(28)30-14-23(27)22-13-16(2)26(17(22)3)20-9-7-19(25)8-10-20/h5-13H,4,14-15H2,1-3H3 |
| InChIKey | CSSLUEHYJUVPOD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|