C24H30N2O5 — CID 7727203
[2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727203) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is [2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727203 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | CCOc1ccc(-n2c(C)cc(C(=O)COC(=O)CN3CCCCCC3=O)c2C)cc1 |
| InChI | InChI=1S/C24H30N2O5/c1-4-30-20-11-9-19(10-12-20)26-17(2)14-21(18(26)3)22(27)16-31-24(29)15-25-13-7-5-6-8-23(25)28/h9-12,14H,4-8,13,15-16H2,1-3H3 |
| InChIKey | DSOZLGJUMBDKHP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|