C24H20FN3O4 — CID 3616050
[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 3616050) has the molecular formula C24H20FN3O4 and a molecular weight of 433.44 g/mol. Its IUPAC name is [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 3616050 |
| Molecular Formula | C24H20FN3O4 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2nn(C)c(=O)c3ccccc23)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H20FN3O4/c1-14-12-20(15(2)28(14)17-10-8-16(25)9-11-17)21(29)13-32-24(31)22-18-6-4-5-7-19(18)23(30)27(3)26-22/h4-12H,13H2,1-3H3 |
| InChIKey | RCLOXAUIEONHBY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|