C20H17Cl2NO3S — CID 3355777
[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 3355777) has the molecular formula C20H17Cl2NO3S and a molecular weight of 422.33 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 3355777 |
| Molecular Formula | C20H17Cl2NO3S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | Cc1cc(C(=O)COC(=O)Cc2ccsc2)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2NO3S/c1-12-7-16(13(2)23(12)15-3-4-17(21)18(22)9-15)19(24)10-26-20(25)8-14-5-6-27-11-14/h3-7,9,11H,8,10H2,1-2H3 |
| InChIKey | SJUBLGOMXNPTCR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|