C26H20ClNO5 — CID 5108243
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 5108243) has the molecular formula C26H20ClNO5 and a molecular weight of 461.90 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 5108243 |
| Molecular Formula | C26H20ClNO5 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)c2ccc3c(c2Cl)C(=O)c2ccccc2C3=O)c1C |
| InChI | InChI=1S/C26H20ClNO5/c1-4-11-28-14(2)12-20(15(28)3)21(29)13-33-26(32)19-10-9-18-22(23(19)27)25(31)17-8-6-5-7-16(17)24(18)30/h4-10,12H,1,11,13H2,2-3H3 |
| InChIKey | XJVBWJJOSVBJDN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|