C25H22ClNO4 — CID 2083733
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate (PubChem CID 2083733) has the molecular formula C25H22ClNO4 and a molecular weight of 435.91 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 2083733 |
| Molecular Formula | C25H22ClNO4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C25H22ClNO4/c1-4-13-27-16(2)14-22(17(27)3)23(28)15-31-25(30)21-8-6-5-7-20(21)24(29)18-9-11-19(26)12-10-18/h4-12,14H,1,13,15H2,2-3H3 |
| InChIKey | KRNDXZUYEYJWLA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|