C23H24N2O5S2 — CID 87845143
[4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl] acetate (PubChem CID 87845143) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is [4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl] acetate.
| Compound Name | [4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 87845143 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | [4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl] acetate |
| SMILES | CC(=O)Nc1nc(CCc2ccc(OC(C)=O)cc2)c(Cc2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C23H24N2O5S2/c1-15(26)24-23-25-21(13-8-17-4-9-19(10-5-17)30-16(2)27)22(31-23)14-18-6-11-20(12-7-18)32(3,28)29/h4-7,9-12H,8,13-14H2,1-3H3,(H,24,25,26) |
| InChIKey | ILWBFMAFFQLRPN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|