C20H26N6O2S — CID 89231767
N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(2R)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 89231767) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(2R)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(2R)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 89231767 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(2R)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N=C(N)N)cc2)c(C(=O)N2CCC[C@H]2C)s1 |
| InChI | InChI=1S/C20H26N6O2S/c1-12-4-3-11-26(12)18(28)17-16(25-20(29-17)23-13(2)27)10-7-14-5-8-15(9-6-14)24-19(21)22/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H4,21,22,24)(H,23,25,27)/t12-/m1/s1 |
| InChIKey | FPHUTVVKULLVIQ-GFCCVEGCSA-N |
| XLogP | 2.42 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|