C23H33N7O2S — CID 87985606
(3S)-1-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 87985606) has the molecular formula C23H33N7O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is (3S)-1-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 87985606 |
| Molecular Formula | C23H33N7O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (3S)-1-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(/N=C/NN)cc2)c(CN2CCC[C@H](C(=O)N(C)C)C2)s1 |
| InChI | InChI=1S/C23H33N7O2S/c1-16(31)27-23-28-20(11-8-17-6-9-19(10-7-17)25-15-26-24)21(33-23)14-30-12-4-5-18(13-30)22(32)29(2)3/h6-7,9-10,15,18H,4-5,8,11-14,24H2,1-3H3,(H,25,26)(H,27,28,31)/t18-/m0/s1 |
| InChIKey | IHLFIWAAULTRGJ-SFHVURJKSA-N |
| XLogP | 2.31 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|