C21H29N7O3S — CID 143109767
N-[(5R)-5-(4-acetylpiperazine-1-carbonyl)-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]acetamide (PubChem CID 143109767) has the molecular formula C21H29N7O3S and a molecular weight of 459.58 g/mol. Its IUPAC name is N-[(5R)-5-(4-acetylpiperazine-1-carbonyl)-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(5R)-5-(4-acetylpiperazine-1-carbonyl)-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 143109767 |
| Molecular Formula | C21H29N7O3S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[(5R)-5-(4-acetylpiperazine-1-carbonyl)-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(CCc2ccc(N=C(N)N)cc2)[C@H](C(=O)N2CCN(C(C)=O)CC2)S1 |
| InChI | InChI=1S/C21H29N7O3S/c1-13(29)24-21-26-17(8-5-15-3-6-16(7-4-15)25-20(22)23)18(32-21)19(31)28-11-9-27(10-12-28)14(2)30/h3-4,6-7,17-18H,5,8-12H2,1-2H3,(H4,22,23,25)(H,24,26,29)/t17?,18-/m1/s1 |
| InChIKey | NGDPASKKOMWLEY-QRWMCTBCSA-N |
| XLogP | 0.19 |
| TPSA | 146.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|