C24H26N4O3S3 — CID 58720255
N-[4-[2-[4-(4,5-dihydro-1,3-thiazol-2-ylamino)phenyl]ethyl]-5-[(4-methylperoxysulfanylphenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 58720255) has the molecular formula C24H26N4O3S3 and a molecular weight of 514.70 g/mol. Its IUPAC name is N-[4-[2-[4-(4,5-dihydro-1,3-thiazol-2-ylamino)phenyl]ethyl]-5-[(4-methylperoxysulfanylphenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-[4-(4,5-dihydro-1,3-thiazol-2-ylamino)phenyl]ethyl]-5-[(4-methylperoxysulfanylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 58720255 |
| Molecular Formula | C24H26N4O3S3 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | N-[4-[2-[4-(4,5-dihydro-1,3-thiazol-2-ylamino)phenyl]ethyl]-5-[(4-methylperoxysulfanylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COOSc1ccc(Cc2sc(NC(C)=O)nc2CCc2ccc(NC3=NCCS3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O3S3/c1-16(29)26-24-28-21(22(33-24)15-18-5-10-20(11-6-18)34-31-30-2)12-7-17-3-8-19(9-4-17)27-23-25-13-14-32-23/h3-6,8-11H,7,12-15H2,1-2H3,(H,25,27)(H,26,28,29) |
| InChIKey | UBWPJAGVZVFZKI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|