C26H24N2O4 — CID 134959377
methyl 4-[[4-[[(4-methoxycarbonylphenyl)methylideneamino]methyl]phenyl]methyliminomethyl]benzoate (PubChem CID 134959377) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl 4-[[4-[[(4-methoxycarbonylphenyl)methylideneamino]methyl]phenyl]methyliminomethyl]benzoate.
| Compound Name | methyl 4-[[4-[[(4-methoxycarbonylphenyl)methylideneamino]methyl]phenyl]methyliminomethyl]benzoate |
|---|---|
| PubChem CID | 134959377 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | methyl 4-[[4-[[(4-methoxycarbonylphenyl)methylideneamino]methyl]phenyl]methyliminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/Cc2ccc(C/N=C/c3ccc(C(=O)OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-31-25(29)23-11-7-21(8-12-23)17-27-15-19-3-5-20(6-4-19)16-28-18-22-9-13-24(14-10-22)26(30)32-2/h3-14,17-18H,15-16H2,1-2H3/b27-17+,28-18+ |
| InChIKey | GNNYEKYOVCCVPQ-XUIWWLCJSA-N |
| XLogP | 4.50 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|